C16H23ClN2 — CID 83996341
1-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)piperidin-3-amine (PubChem CID 83996341) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)piperidin-3-amine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 83996341 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)piperidin-3-amine |
| SMILES | Clc1cccc(CN2CCCC(NCC3CC3)C2)c1 |
| InChI | InChI=1S/C16H23ClN2/c17-15-4-1-3-14(9-15)11-19-8-2-5-16(12-19)18-10-13-6-7-13/h1,3-4,9,13,16,18H,2,5-8,10-12H2 |
| InChIKey | OWPPSSNQRNLCKJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |