C8H4Cl4O2S — CID 840272
(5-chlorothiophen-2-yl)-[(2R,3S)-3-(trichloromethyl)oxiran-2-yl]methanone (PubChem CID 840272) has the molecular formula C8H4Cl4O2S and a molecular weight of 306.00 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[(2R,3S)-3-(trichloromethyl)oxiran-2-yl]methanone.
| Compound Name | (5-chlorothiophen-2-yl)-[(2R,3S)-3-(trichloromethyl)oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 840272 |
| Molecular Formula | C8H4Cl4O2S |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.87 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[(2R,3S)-3-(trichloromethyl)oxiran-2-yl]methanone |
| SMILES | O=C(c1ccc(Cl)s1)[C@@H]1O[C@@H]1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H4Cl4O2S/c9-4-2-1-3(15-4)5(13)6-7(14-6)8(10,11)12/h1-2,6-7H/t6-,7-/m0/s1 |
| InChIKey | DOYFRJYTPOFEQR-BQBZGAKWSA-N |
| XLogP | 3.72 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|