C14H16ClN5OS — CID 842682
1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(4-methylphenyl)thiourea (PubChem CID 842682) has the molecular formula C14H16ClN5OS and a molecular weight of 337.84 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 842682 |
| Molecular Formula | C14H16ClN5OS |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)c2c(Cl)c(C)nn2C)cc1 |
| InChI | InChI=1S/C14H16ClN5OS/c1-8-4-6-10(7-5-8)16-14(22)18-17-13(21)12-11(15)9(2)19-20(12)3/h4-7H,1-3H3,(H,17,21)(H2,16,18,22) |
| InChIKey | TZTXGYKHZAKELD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|