C13H14ClN5OS — CID 842888
1-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]-3-phenylthiourea (PubChem CID 842888) has the molecular formula C13H14ClN5OS and a molecular weight of 323.81 g/mol. Its IUPAC name is 1-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]-3-phenylthiourea.
| Compound Name | 1-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 842888 |
| Molecular Formula | C13H14ClN5OS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]-3-phenylthiourea |
| SMILES | Cc1c(Cl)c(C(=O)NNC(=S)Nc2ccccc2)nn1C |
| InChI | InChI=1S/C13H14ClN5OS/c1-8-10(14)11(18-19(8)2)12(20)16-17-13(21)15-9-6-4-3-5-7-9/h3-7H,1-2H3,(H,16,20)(H2,15,17,21) |
| InChIKey | PJVBDTHYBRVLSE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|