C17H21N3OS2 — CID 843881
1-(2,5-dimethylphenyl)-3-[(5-propan-2-ylthiophene-3-carbonyl)amino]thiourea (PubChem CID 843881) has the molecular formula C17H21N3OS2 and a molecular weight of 347.51 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(5-propan-2-ylthiophene-3-carbonyl)amino]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(5-propan-2-ylthiophene-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 843881 |
| Molecular Formula | C17H21N3OS2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(5-propan-2-ylthiophene-3-carbonyl)amino]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NNC(=O)c2csc(C(C)C)c2)c1 |
| InChI | InChI=1S/C17H21N3OS2/c1-10(2)15-8-13(9-23-15)16(21)19-20-17(22)18-14-7-11(3)5-6-12(14)4/h5-10H,1-4H3,(H,19,21)(H2,18,20,22) |
| InChIKey | IMSMDKMTNZYYLM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|