C18H15NO5 — CID 845236
4-[[(2R,3R)-5-oxo-2-phenyloxolane-3-carbonyl]amino]benzoic acid (PubChem CID 845236) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-[[(2R,3R)-5-oxo-2-phenyloxolane-3-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(2R,3R)-5-oxo-2-phenyloxolane-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 845236 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-[[(2R,3R)-5-oxo-2-phenyloxolane-3-carbonyl]amino]benzoic acid |
| SMILES | O=C1C[C@@H](C(=O)Nc2ccc(C(=O)O)cc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C18H15NO5/c20-15-10-14(16(24-15)11-4-2-1-3-5-11)17(21)19-13-8-6-12(7-9-13)18(22)23/h1-9,14,16H,10H2,(H,19,21)(H,22,23)/t14-,16+/m1/s1 |
| InChIKey | MTCQAHCLMSBPEB-ZBFHGGJFSA-N |
| XLogP | 2.63 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |