C7H12N4OS — CID 84551771
2-(2-aminoethylsulfanyl)-N-(1H-pyrazol-5-yl)acetamide (PubChem CID 84551771) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-(1H-pyrazol-5-yl)acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-(1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 84551771 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-(1H-pyrazol-5-yl)acetamide |
| SMILES | NCCSCC(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C7H12N4OS/c8-2-4-13-5-7(12)10-6-1-3-9-11-6/h1,3H,2,4-5,8H2,(H2,9,10,11,12) |
| InChIKey | SSXQWCCFSQXCOZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|