C17H9Cl2N3O2 — CID 84552909
N-(2-cyanophenyl)-2-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 84552909) has the molecular formula C17H9Cl2N3O2 and a molecular weight of 358.18 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-cyanophenyl)-2-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 84552909 |
| Molecular Formula | C17H9Cl2N3O2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-(2-cyanophenyl)-2-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1coc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H9Cl2N3O2/c18-12-6-5-10(7-13(12)19)17-22-15(9-24-17)16(23)21-14-4-2-1-3-11(14)8-20/h1-7,9H,(H,21,23) |
| InChIKey | UXSJKKOIBBDTIG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |