C18H15BrN2O3 — CID 84558997
5-bromo-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]furan-2-carboxamide (PubChem CID 84558997) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is 5-bromo-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 84558997 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 5-bromo-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1COc1cccnc1NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H15BrN2O3/c1-12-5-2-3-6-13(12)11-23-14-7-4-10-20-17(14)21-18(22)15-8-9-16(19)24-15/h2-10H,11H2,1H3,(H,20,21,22) |
| InChIKey | BYCGXPDTPOPTCY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |