C24H21N3O4 — CID 84559542
3-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]propanamide (PubChem CID 84559542) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 84559542 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]propanamide |
| SMILES | Cc1ccccc1COc1cccnc1NC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H21N3O4/c1-16-7-2-3-8-17(16)15-31-20-11-6-13-25-22(20)26-21(28)12-14-27-23(29)18-9-4-5-10-19(18)24(27)30/h2-11,13H,12,14-15H2,1H3,(H,25,26,28) |
| InChIKey | HRDLYMXLBLYUIG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|