C25H23N3O4 — CID 84559868
4-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]butanamide (PubChem CID 84559868) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]butanamide |
|---|---|
| PubChem CID | 84559868 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[3-[(2-methylphenyl)methoxy]-2-pyridinyl]butanamide |
| SMILES | Cc1ccccc1COc1cccnc1NC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H23N3O4/c1-17-8-2-3-9-18(17)16-32-21-12-6-14-26-23(21)27-22(29)13-7-15-28-24(30)19-10-4-5-11-20(19)25(28)31/h2-6,8-12,14H,7,13,15-16H2,1H3,(H,26,27,29) |
| InChIKey | WABVFVGAHVNLKT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|