About 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one
1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one (PubChem CID 84560090) has the molecular formula C10H9F3N2O2S
and a molecular weight of 278.25 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one |
| PubChem CID | 84560090 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one |
| SMILES | O=C1CCN(C(=O)c2scnc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H9F3N2O2S/c11-10(12,13)8-7(18-5-14-8)9(17)15-3-1-6(16)2-4-15/h5H,1-4H2 |
| InChIKey | XUINHOWVPBRDHR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one?
The IUPAC name of 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one (CID 84560090) is 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one.
What is the SMILES notation for 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one?
The canonical SMILES for 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one is O=C1CCN(C(=O)c2scnc2C(F)(F)F)CC1.
What is the InChIKey of 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one?
The InChIKey is XUINHOWVPBRDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O2S/c11-10(12,13)8-7(18-5-14-8)9(17)15-3-1-6(16)2-4-15/h5H,1-4H2.
What are the key properties of 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one?
1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one has a molecular weight of 278.25 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]piperidin-4-one is sourced from PubChem (CID 84560090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).