C13H15F3N2O2S — CID 138045955
[(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 138045955) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | [(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 138045955 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | CC1(C)CN(C(=O)c2scnc2C(F)(F)F)[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C13H15F3N2O2S/c1-12(2)5-18(8-4-20-3-7(8)12)11(19)9-10(13(14,15)16)17-6-21-9/h6-8H,3-5H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | IYVMYEMJXKTKAE-JGVFFNPUSA-N |
| XLogP | 2.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |