C15H16N4O — CID 84570874
6-(cyclopropylamino)-N-(pyridin-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 84570874) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-(cyclopropylamino)-N-(pyridin-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 6-(cyclopropylamino)-N-(pyridin-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 84570874 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 6-(cyclopropylamino)-N-(pyridin-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cccc(NC2CC2)n1 |
| InChI | InChI=1S/C15H16N4O/c20-15(17-10-12-4-1-2-9-16-12)13-5-3-6-14(19-13)18-11-7-8-11/h1-6,9,11H,7-8,10H2,(H,17,20)(H,18,19) |
| InChIKey | BAQMMIZSDZYVOQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |