C21H27NO6 — CID 84572238
butan-2-yl 2-[[1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-4-oxo-3-pyridinyl]oxy]acetate (PubChem CID 84572238) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is butan-2-yl 2-[[1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-4-oxo-3-pyridinyl]oxy]acetate.
| Compound Name | butan-2-yl 2-[[1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-4-oxo-3-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 84572238 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | butan-2-yl 2-[[1-[2-(4-methoxyphenoxy)ethyl]-2-methyl-4-oxo-3-pyridinyl]oxy]acetate |
| SMILES | CCC(C)OC(=O)COc1c(C)n(CCOc2ccc(OC)cc2)ccc1=O |
| InChI | InChI=1S/C21H27NO6/c1-5-15(2)28-20(24)14-27-21-16(3)22(11-10-19(21)23)12-13-26-18-8-6-17(25-4)7-9-18/h6-11,15H,5,12-14H2,1-4H3 |
| InChIKey | KTRMSWSQNUFLQO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |