C23H26N2O2 — CID 84576768
N-benzhydryl-2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetamide (PubChem CID 84576768) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-benzhydryl-2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetamide.
| Compound Name | N-benzhydryl-2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 84576768 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-benzhydryl-2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetamide |
| SMILES | Cc1nc(C(C)(C)C)oc1CC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2/c1-16-19(27-22(24-16)23(2,3)4)15-20(26)25-21(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,21H,15H2,1-4H3,(H,25,26) |
| InChIKey | POFMRCMFSAQNNU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |