C17H29N3O3 — CID 84577008
2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 84577008) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 84577008 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | Cc1nc(C(C)(C)C)oc1CC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H29N3O3/c1-13-14(23-16(19-13)17(2,3)4)12-15(21)18-6-5-7-20-8-10-22-11-9-20/h5-12H2,1-4H3,(H,18,21) |
| InChIKey | OIWITAKJDPWNFZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|