C13H16N2O2 — CID 84580497
2-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide (PubChem CID 84580497) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide.
| Compound Name | 2-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 84580497 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccnc(OC)c1 |
| InChI | InChI=1S/C13H16N2O2/c1-4-8-15(9-5-2)13(16)11-6-7-14-12(10-11)17-3/h4-7,10H,1-2,8-9H2,3H3 |
| InChIKey | HTOUMUYOQNJSHR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|