C13H15ClN2O2 — CID 84580756
2-chloro-6-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide (PubChem CID 84580756) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 2-chloro-6-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 84580756 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-chloro-6-methoxy-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(Cl)nc(OC)c1 |
| InChI | InChI=1S/C13H15ClN2O2/c1-4-6-16(7-5-2)13(17)10-8-11(14)15-12(9-10)18-3/h4-5,8-9H,1-2,6-7H2,3H3 |
| InChIKey | GDDDUESRLIOXJS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|