C19H17FN2O — CID 84582019
3-fluoro-N-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide (PubChem CID 84582019) has the molecular formula C19H17FN2O and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-fluoro-N-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide.
| Compound Name | 3-fluoro-N-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide |
|---|---|
| PubChem CID | 84582019 |
| Molecular Formula | C19H17FN2O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-fluoro-N-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC(NC(=O)c1cccc(F)c1)C3 |
| InChI | InChI=1S/C19H17FN2O/c1-11-5-6-17-15(7-11)16-9-14(10-18(16)22-17)21-19(23)12-3-2-4-13(20)8-12/h2-8,14,22H,9-10H2,1H3,(H,21,23) |
| InChIKey | GQABFCPQRNREOW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|