C13H13ClN4O3 — CID 84584328
N'-(4-chloro-2-methylphenyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxamide (PubChem CID 84584328) has the molecular formula C13H13ClN4O3 and a molecular weight of 308.73 g/mol. Its IUPAC name is N'-(4-chloro-2-methylphenyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxamide.
| Compound Name | N'-(4-chloro-2-methylphenyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxamide |
|---|---|
| PubChem CID | 84584328 |
| Molecular Formula | C13H13ClN4O3 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N'-(4-chloro-2-methylphenyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxamide |
| SMILES | Cc1noc(CNC(=O)C(=O)Nc2ccc(Cl)cc2C)n1 |
| InChI | InChI=1S/C13H13ClN4O3/c1-7-5-9(14)3-4-10(7)17-13(20)12(19)15-6-11-16-8(2)18-21-11/h3-5H,6H2,1-2H3,(H,15,19)(H,17,20) |
| InChIKey | GAGRWJIJFSQQPZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|