C17H15ClN4 — CID 84586318
3-(4-chlorophenyl)-N-methyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)prop-2-yn-1-amine (PubChem CID 84586318) has the molecular formula C17H15ClN4 and a molecular weight of 310.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-methyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)prop-2-yn-1-amine.
| Compound Name | 3-(4-chlorophenyl)-N-methyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 84586318 |
| Molecular Formula | C17H15ClN4 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-(4-chlorophenyl)-N-methyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)prop-2-yn-1-amine |
| SMILES | CN(CC#Cc1ccc(Cl)cc1)Cc1nnc2ccccn12 |
| InChI | InChI=1S/C17H15ClN4/c1-21(11-4-5-14-7-9-15(18)10-8-14)13-17-20-19-16-6-2-3-12-22(16)17/h2-3,6-10,12H,11,13H2,1H3 |
| InChIKey | GSVKPGAFDQPWRH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|