C17H17F2N5O — CID 84589164
N-[2-(2,4-difluorophenoxy)ethyl]-1-[4-(tetrazol-1-yl)phenyl]ethanamine (PubChem CID 84589164) has the molecular formula C17H17F2N5O and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenoxy)ethyl]-1-[4-(tetrazol-1-yl)phenyl]ethanamine.
| Compound Name | N-[2-(2,4-difluorophenoxy)ethyl]-1-[4-(tetrazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 84589164 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[2-(2,4-difluorophenoxy)ethyl]-1-[4-(tetrazol-1-yl)phenyl]ethanamine |
| SMILES | CC(NCCOc1ccc(F)cc1F)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C17H17F2N5O/c1-12(13-2-5-15(6-3-13)24-11-21-22-23-24)20-8-9-25-17-7-4-14(18)10-16(17)19/h2-7,10-12,20H,8-9H2,1H3 |
| InChIKey | XYJOFDQWOZUOFN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|