C14H15F3N2O3S — CID 84590420
1-(2-methylsulfonylimidazol-1-yl)-3-[2-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 84590420) has the molecular formula C14H15F3N2O3S and a molecular weight of 348.35 g/mol. Its IUPAC name is 1-(2-methylsulfonylimidazol-1-yl)-3-[2-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-(2-methylsulfonylimidazol-1-yl)-3-[2-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 84590420 |
| Molecular Formula | C14H15F3N2O3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-(2-methylsulfonylimidazol-1-yl)-3-[2-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CS(=O)(=O)c1nccn1CC(O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O3S/c1-23(21,22)13-18-6-7-19(13)9-11(20)8-10-4-2-3-5-12(10)14(15,16)17/h2-7,11,20H,8-9H2,1H3 |
| InChIKey | PMMLEKJHOINFCZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |