C15H14N2O2S2 — CID 84591571
5-phenyl-3-(1-thiophen-2-ylethylsulfinylmethyl)-1,2,4-oxadiazole (PubChem CID 84591571) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 5-phenyl-3-(1-thiophen-2-ylethylsulfinylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-phenyl-3-(1-thiophen-2-ylethylsulfinylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 84591571 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 5-phenyl-3-(1-thiophen-2-ylethylsulfinylmethyl)-1,2,4-oxadiazole |
| SMILES | CC(c1cccs1)S(=O)Cc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H14N2O2S2/c1-11(13-8-5-9-20-13)21(18)10-14-16-15(19-17-14)12-6-3-2-4-7-12/h2-9,11H,10H2,1H3 |
| InChIKey | XHFNFEOSFZWVCM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |