C16H18N2O4 — CID 84593532
tert-butyl 4-[(5-methyl-1,2-oxazol-4-yl)carbamoyl]benzoate (PubChem CID 84593532) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is tert-butyl 4-[(5-methyl-1,2-oxazol-4-yl)carbamoyl]benzoate.
| Compound Name | tert-butyl 4-[(5-methyl-1,2-oxazol-4-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 84593532 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | tert-butyl 4-[(5-methyl-1,2-oxazol-4-yl)carbamoyl]benzoate |
| SMILES | Cc1oncc1NC(=O)c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H18N2O4/c1-10-13(9-17-22-10)18-14(19)11-5-7-12(8-6-11)15(20)21-16(2,3)4/h5-9H,1-4H3,(H,18,19) |
| InChIKey | WMPQGNJGHNCNAK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |