C10H18N2O2S2 — CID 84597266
4,5-dimethyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide (PubChem CID 84597266) has the molecular formula C10H18N2O2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 4,5-dimethyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide.
| Compound Name | 4,5-dimethyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 84597266 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4,5-dimethyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide |
| SMILES | CNCCCNS(=O)(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C10H18N2O2S2/c1-8-7-10(15-9(8)2)16(13,14)12-6-4-5-11-3/h7,11-12H,4-6H2,1-3H3 |
| InChIKey | IHALZRIHSDBXNZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|