C15H21F2NO2S — CID 84599082
N-[3-(3,5-difluorophenyl)propyl]-2-methylsulfonylcyclopentan-1-amine (PubChem CID 84599082) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[3-(3,5-difluorophenyl)propyl]-2-methylsulfonylcyclopentan-1-amine.
| Compound Name | N-[3-(3,5-difluorophenyl)propyl]-2-methylsulfonylcyclopentan-1-amine |
|---|---|
| PubChem CID | 84599082 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[3-(3,5-difluorophenyl)propyl]-2-methylsulfonylcyclopentan-1-amine |
| SMILES | CS(=O)(=O)C1CCCC1NCCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H21F2NO2S/c1-21(19,20)15-6-2-5-14(15)18-7-3-4-11-8-12(16)10-13(17)9-11/h8-10,14-15,18H,2-7H2,1H3 |
| InChIKey | IESAKJYTCBADTM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|