C13H17N3O4S — CID 84599399
2-(6-azaspiro[3.4]octan-6-yl)-4-nitrobenzenesulfonamide (PubChem CID 84599399) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-(6-azaspiro[3.4]octan-6-yl)-4-nitrobenzenesulfonamide.
| Compound Name | 2-(6-azaspiro[3.4]octan-6-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 84599399 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(6-azaspiro[3.4]octan-6-yl)-4-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc([N+](=O)[O-])cc1N1CCC2(CCC2)C1 |
| InChI | InChI=1S/C13H17N3O4S/c14-21(19,20)12-3-2-10(16(17)18)8-11(12)15-7-6-13(9-15)4-1-5-13/h2-3,8H,1,4-7,9H2,(H2,14,19,20) |
| InChIKey | WHRRVFPSEDHIOS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|