C20H29N3O3 — CID 84601474
4-[(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-N,N-dimethylbenzamide (PubChem CID 84601474) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 84601474 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-[(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-N,N-dimethylbenzamide |
| SMILES | CCCCCCC1(C)NC(=O)N(Cc2ccc(C(=O)N(C)C)cc2)C1=O |
| InChI | InChI=1S/C20H29N3O3/c1-5-6-7-8-13-20(2)18(25)23(19(26)21-20)14-15-9-11-16(12-10-15)17(24)22(3)4/h9-12H,5-8,13-14H2,1-4H3,(H,21,26) |
| InChIKey | ZDZJCNWVZIYITG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|