C13H13Cl2NO3 — CID 84603951
[2-(4-methylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 84603951) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 84603951 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C13H13Cl2NO3/c1-8-2-4-9(5-3-8)16-11(17)7-19-12(18)10-6-13(10,14)15/h2-5,10H,6-7H2,1H3,(H,16,17) |
| InChIKey | ALERHKDITPAVPK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|