C15H19BrN2O — CID 84605575
1-(3-bromophenyl)-3,3-dimethyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-2-one (PubChem CID 84605575) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3,3-dimethyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-2-one.
| Compound Name | 1-(3-bromophenyl)-3,3-dimethyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 84605575 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-(3-bromophenyl)-3,3-dimethyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-2-one |
| SMILES | CC1(C)C(=O)N(c2cccc(Br)c2)C2CCCNC21 |
| InChI | InChI=1S/C15H19BrN2O/c1-15(2)13-12(7-4-8-17-13)18(14(15)19)11-6-3-5-10(16)9-11/h3,5-6,9,12-13,17H,4,7-8H2,1-2H3 |
| InChIKey | QNXYPVHPAWQYSE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |