C16H25BrN2 — CID 84606565
1-(3-bromo-4-methylphenyl)-2,2,6,6-tetramethyl-1,4-diazepane (PubChem CID 84606565) has the molecular formula C16H25BrN2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-2,2,6,6-tetramethyl-1,4-diazepane.
| Compound Name | 1-(3-bromo-4-methylphenyl)-2,2,6,6-tetramethyl-1,4-diazepane |
|---|---|
| PubChem CID | 84606565 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-2,2,6,6-tetramethyl-1,4-diazepane |
| SMILES | Cc1ccc(N2CC(C)(C)CNCC2(C)C)cc1Br |
| InChI | InChI=1S/C16H25BrN2/c1-12-6-7-13(8-14(12)17)19-11-15(2,3)9-18-10-16(19,4)5/h6-8,18H,9-11H2,1-5H3 |
| InChIKey | IARFMZQOJHZPAB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |