C12H17BrN2 — CID 178198080
(3R,4S)-4-(3-bromo-4-methylphenyl)-3-methylpyrrolidin-3-amine (PubChem CID 178198080) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is (3R,4S)-4-(3-bromo-4-methylphenyl)-3-methylpyrrolidin-3-amine.
| Compound Name | (3R,4S)-4-(3-bromo-4-methylphenyl)-3-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 178198080 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (3R,4S)-4-(3-bromo-4-methylphenyl)-3-methylpyrrolidin-3-amine |
| SMILES | Cc1ccc([C@H]2CNC[C@]2(C)N)cc1Br |
| InChI | InChI=1S/C12H17BrN2/c1-8-3-4-9(5-11(8)13)10-6-15-7-12(10,2)14/h3-5,10,15H,6-7,14H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | JWYXLPAMSBTHSV-PWSUYJOCSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |