C14H15N3O — CID 84612878
1,9-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-5-carboxamide (PubChem CID 84612878) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 1,9-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-5-carboxamide.
| Compound Name | 1,9-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 84612878 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1,9-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]c3c(c2c1)N1CCC3CC1 |
| InChI | InChI=1S/C14H15N3O/c15-14(18)9-1-2-11-10(7-9)13-12(16-11)8-3-5-17(13)6-4-8/h1-2,7-8,16H,3-6H2,(H2,15,18) |
| InChIKey | GTQNZNGXUSTSIM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |