C21H23N3O — CID 84613109
N-(3-aminophenyl)-8,9-dimethyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide (PubChem CID 84613109) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(3-aminophenyl)-8,9-dimethyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide.
| Compound Name | N-(3-aminophenyl)-8,9-dimethyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide |
|---|---|
| PubChem CID | 84613109 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-(3-aminophenyl)-8,9-dimethyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide |
| SMILES | CC1CCCc2c1n(C)c1c(C(=O)Nc3cccc(N)c3)cccc21 |
| InChI | InChI=1S/C21H23N3O/c1-13-6-3-9-16-17-10-5-11-18(20(17)24(2)19(13)16)21(25)23-15-8-4-7-14(22)12-15/h4-5,7-8,10-13H,3,6,9,22H2,1-2H3,(H,23,25) |
| InChIKey | SULDIRSGPARBAW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|