C20H21N3O — CID 84613696
N-(4-aminophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide (PubChem CID 84613696) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(4-aminophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide.
| Compound Name | N-(4-aminophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide |
|---|---|
| PubChem CID | 84613696 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(4-aminophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-1-carboxamide |
| SMILES | Cn1c2c(c3cccc(C(=O)Nc4ccc(N)cc4)c31)CCCC2 |
| InChI | InChI=1S/C20H21N3O/c1-23-18-8-3-2-5-15(18)16-6-4-7-17(19(16)23)20(24)22-14-11-9-13(21)10-12-14/h4,6-7,9-12H,2-3,5,8,21H2,1H3,(H,22,24) |
| InChIKey | AZGUIWYNCHLONU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|