C7H11F2NO2 — CID 84614619
2-(4,4-difluoropiperidin-1-yl)acetic acid (PubChem CID 84614619) has the molecular formula C7H11F2NO2 and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)acetic acid.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 84614619 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)acetic acid |
| SMILES | O=C(O)CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H11F2NO2/c8-7(9)1-3-10(4-2-7)5-6(11)12/h1-5H2,(H,11,12) |
| InChIKey | UGJLASMURDCZAZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |