2-(4,4-difluoropiperidin-1-yl)acetic acid

C7H11F2NO2 — CID 84614619

IUPAC2-(4,4-difluoropiperidin-1-yl)acetic acid
SMILESO=C(O)CN1CCC(F)(F)CC1
InChIInChI=1S/C7H11F2NO2/c8-7(9)1-3-10(4-2-7)5-6(11)12/h1-5H2,(H,11,12)
InChIKeyUGJLASMURDCZAZ-UHFFFAOYSA-N
MW179.17 g/mol
LogP0.80
Rot. Bonds2

About 2-(4,4-difluoropiperidin-1-yl)acetic acid

2-(4,4-difluoropiperidin-1-yl)acetic acid (PubChem CID 84614619) has the molecular formula C7H11F2NO2 and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4,4-difluoropiperidin-1-yl)acetic acid
PubChem CID84614619
Molecular FormulaC7H11F2NO2
Molecular Weight179.17 g/mol
Exact Mass179.08
IUPAC Name2-(4,4-difluoropiperidin-1-yl)acetic acid
SMILESO=C(O)CN1CCC(F)(F)CC1
InChIInChI=1S/C7H11F2NO2/c8-7(9)1-3-10(4-2-7)5-6(11)12/h1-5H2,(H,11,12)
InChIKeyUGJLASMURDCZAZ-UHFFFAOYSA-N
XLogP0.80
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.17
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4,4-difluoropiperidin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-difluoropiperidin-1-yl)acetic acid?
The IUPAC name of 2-(4,4-difluoropiperidin-1-yl)acetic acid (CID 84614619) is 2-(4,4-difluoropiperidin-1-yl)acetic acid.
What is the SMILES notation for 2-(4,4-difluoropiperidin-1-yl)acetic acid?
The canonical SMILES for 2-(4,4-difluoropiperidin-1-yl)acetic acid is O=C(O)CN1CCC(F)(F)CC1.
What is the InChIKey of 2-(4,4-difluoropiperidin-1-yl)acetic acid?
The InChIKey is UGJLASMURDCZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c8-7(9)1-3-10(4-2-7)5-6(11)12/h1-5H2,(H,11,12).
What are the key properties of 2-(4,4-difluoropiperidin-1-yl)acetic acid?
2-(4,4-difluoropiperidin-1-yl)acetic acid has a molecular weight of 179.17 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoropiperidin-1-yl)acetic acid is sourced from PubChem (CID 84614619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).