C13H15NO4S — CID 84615317
7-acetyl-4-(2,3-dihydroxypropyl)-1,4-benzothiazin-3-one (PubChem CID 84615317) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 7-acetyl-4-(2,3-dihydroxypropyl)-1,4-benzothiazin-3-one.
| Compound Name | 7-acetyl-4-(2,3-dihydroxypropyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615317 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 7-acetyl-4-(2,3-dihydroxypropyl)-1,4-benzothiazin-3-one |
| SMILES | CC(=O)c1ccc2c(c1)SCC(=O)N2CC(O)CO |
| InChI | InChI=1S/C13H15NO4S/c1-8(16)9-2-3-11-12(4-9)19-7-13(18)14(11)5-10(17)6-15/h2-4,10,15,17H,5-7H2,1H3 |
| InChIKey | MHGUGJAKFVVNNI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |