C13H14FNO2S — CID 84615390
4-(2-fluoroethyl)-7-propanoyl-1,4-benzothiazin-3-one (PubChem CID 84615390) has the molecular formula C13H14FNO2S and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-7-propanoyl-1,4-benzothiazin-3-one.
| Compound Name | 4-(2-fluoroethyl)-7-propanoyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615390 |
| Molecular Formula | C13H14FNO2S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-(2-fluoroethyl)-7-propanoyl-1,4-benzothiazin-3-one |
| SMILES | CCC(=O)c1ccc2c(c1)SCC(=O)N2CCF |
| InChI | InChI=1S/C13H14FNO2S/c1-2-11(16)9-3-4-10-12(7-9)18-8-13(17)15(10)6-5-14/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | WUXSOCQPWYIHKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |