C12H13N3S — CID 84617278
3-(1,5-dimethylbenzimidazol-2-yl)sulfanylpropanenitrile (PubChem CID 84617278) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-(1,5-dimethylbenzimidazol-2-yl)sulfanylpropanenitrile.
| Compound Name | 3-(1,5-dimethylbenzimidazol-2-yl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 84617278 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-(1,5-dimethylbenzimidazol-2-yl)sulfanylpropanenitrile |
| SMILES | Cc1ccc2c(c1)nc(SCCC#N)n2C |
| InChI | InChI=1S/C12H13N3S/c1-9-4-5-11-10(8-9)14-12(15(11)2)16-7-3-6-13/h4-5,8H,3,7H2,1-2H3 |
| InChIKey | PLWXRIQLKXYKRH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|