C13H15N3S — CID 84617296
4-(1,5-dimethylbenzimidazol-2-yl)sulfanylbutanenitrile (PubChem CID 84617296) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-(1,5-dimethylbenzimidazol-2-yl)sulfanylbutanenitrile.
| Compound Name | 4-(1,5-dimethylbenzimidazol-2-yl)sulfanylbutanenitrile |
|---|---|
| PubChem CID | 84617296 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-(1,5-dimethylbenzimidazol-2-yl)sulfanylbutanenitrile |
| SMILES | Cc1ccc2c(c1)nc(SCCCC#N)n2C |
| InChI | InChI=1S/C13H15N3S/c1-10-5-6-12-11(9-10)15-13(16(12)2)17-8-4-3-7-14/h5-6,9H,3-4,8H2,1-2H3 |
| InChIKey | HNWULITVUXGAPQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|