C11H15FN2 — CID 84619292
2-ethyl-6-fluoro-4-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 84619292) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-4-methyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 2-ethyl-6-fluoro-4-methyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 84619292 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-ethyl-6-fluoro-4-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCC1CN(C)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C11H15FN2/c1-3-9-7-14(2)11-6-8(12)4-5-10(11)13-9/h4-6,9,13H,3,7H2,1-2H3 |
| InChIKey | ZLJMACHRGKDPJE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |