C15H18O2 — CID 84626078
(2E)-2-(7-ethyl-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid (PubChem CID 84626078) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2E)-2-(7-ethyl-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid.
| Compound Name | (2E)-2-(7-ethyl-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
|---|---|
| PubChem CID | 84626078 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2E)-2-(7-ethyl-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
| SMILES | CCc1ccc2c(c1)/C(=C/C(=O)O)CC(C)C2 |
| InChI | InChI=1S/C15H18O2/c1-3-11-4-5-12-6-10(2)7-13(9-15(16)17)14(12)8-11/h4-5,8-10H,3,6-7H2,1-2H3,(H,16,17)/b13-9+ |
| InChIKey | OULFJQVDMBIUSG-UKTHLTGXSA-N |
| XLogP | 3.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|