C11H13NO3S — CID 84629443
2,6,7-trimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 84629443) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2,6,7-trimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
| Compound Name | 2,6,7-trimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84629443 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2,6,7-trimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | Cc1cc2c(cc1C)S(=O)(=O)C(C)C(=O)N2 |
| InChI | InChI=1S/C11H13NO3S/c1-6-4-9-10(5-7(6)2)16(14,15)8(3)11(13)12-9/h4-5,8H,1-3H3,(H,12,13) |
| InChIKey | JCEMNNUFGHNDBS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |