C13H16N2O — CID 57408916
3,4,7,8-tetramethyl-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 57408916) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3,4,7,8-tetramethyl-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 3,4,7,8-tetramethyl-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 57408916 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3,4,7,8-tetramethyl-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | CC1=Nc2cc(C)c(C)cc2NC(=O)C1C |
| InChI | InChI=1S/C13H16N2O/c1-7-5-11-12(6-8(7)2)15-13(16)9(3)10(4)14-11/h5-6,9H,1-4H3,(H,15,16) |
| InChIKey | MXEHDTIDPWYJAS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |