C15H22N2O — CID 84632447
1-(5-ethoxy-1,3-dimethylindol-2-yl)-N-methylethanamine (PubChem CID 84632447) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(5-ethoxy-1,3-dimethylindol-2-yl)-N-methylethanamine.
| Compound Name | 1-(5-ethoxy-1,3-dimethylindol-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 84632447 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-(5-ethoxy-1,3-dimethylindol-2-yl)-N-methylethanamine |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(C)NC)n2C |
| InChI | InChI=1S/C15H22N2O/c1-6-18-12-7-8-14-13(9-12)10(2)15(17(14)5)11(3)16-4/h7-9,11,16H,6H2,1-5H3 |
| InChIKey | ZRAOFPBAKDVZCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|