C14H22N2S — CID 84634001
3-(6,8-dimethyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine (PubChem CID 84634001) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-(6,8-dimethyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(6,8-dimethyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 84634001 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-(6,8-dimethyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1CSc2c(C)cc(C)cc2N1 |
| InChI | InChI=1S/C14H22N2S/c1-10-7-11(2)14-13(8-10)16-12(9-17-14)5-4-6-15-3/h7-8,12,15-16H,4-6,9H2,1-3H3 |
| InChIKey | YYBYWBZDUUWDMR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|