C14H14N4O — CID 84635194
2-(9-methoxypyrimido[4,5-b]quinolin-2-yl)ethanamine (PubChem CID 84635194) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(9-methoxypyrimido[4,5-b]quinolin-2-yl)ethanamine.
| Compound Name | 2-(9-methoxypyrimido[4,5-b]quinolin-2-yl)ethanamine |
|---|---|
| PubChem CID | 84635194 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(9-methoxypyrimido[4,5-b]quinolin-2-yl)ethanamine |
| SMILES | COc1cccc2cc3cnc(CCN)nc3nc12 |
| InChI | InChI=1S/C14H14N4O/c1-19-11-4-2-3-9-7-10-8-16-12(5-6-15)17-14(10)18-13(9)11/h2-4,7-8H,5-6,15H2,1H3 |
| InChIKey | GUJVVSMUHVBRBV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|