C14H14N4O — CID 84635207
1-(8-methoxypyrimido[4,5-b]quinolin-2-yl)-N-methylmethanamine (PubChem CID 84635207) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(8-methoxypyrimido[4,5-b]quinolin-2-yl)-N-methylmethanamine.
| Compound Name | 1-(8-methoxypyrimido[4,5-b]quinolin-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 84635207 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-(8-methoxypyrimido[4,5-b]quinolin-2-yl)-N-methylmethanamine |
| SMILES | CNCc1ncc2cc3ccc(OC)cc3nc2n1 |
| InChI | InChI=1S/C14H14N4O/c1-15-8-13-16-7-10-5-9-3-4-11(19-2)6-12(9)17-14(10)18-13/h3-7,15H,8H2,1-2H3 |
| InChIKey | AXTSMWAJJOUVQV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|